C12H24O5 — CID 58836384
2-ethyl-2-[3-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propane-1,3-diol (PubChem CID 58836384) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-ethyl-2-[3-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[3-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 58836384 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-ethyl-2-[3-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propane-1,3-diol |
| SMILES | C=C(C)C(O)OCCCOC(CC)(CO)CO |
| InChI | InChI=1S/C12H24O5/c1-4-12(8-13,9-14)17-7-5-6-16-11(15)10(2)3/h11,13-15H,2,4-9H2,1,3H3 |
| InChIKey | FBHFXLOTOJOLBY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|