C14H34O4Si3 — CID 20705477
1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-2-methylprop-2-en-1-ol (PubChem CID 20705477) has the molecular formula C14H34O4Si3 and a molecular weight of 350.68 g/mol. Its IUPAC name is 1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-2-methylprop-2-en-1-ol.
| Compound Name | 1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 20705477 |
| Molecular Formula | C14H34O4Si3 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)OCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O4Si3/c1-13(2)14(15)16-11-10-12-20(6,7)18-21(8,9)17-19(3,4)5/h14-15H,1,10-12H2,2-9H3 |
| InChIKey | CIBIUHYPLGNIBV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|