C26H58O9Si3 — CID 91532506
butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;1-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]-3-prop-2-enoxypropan-2-ol (PubChem CID 91532506) has the molecular formula C26H58O9Si3 and a molecular weight of 599.00 g/mol. Its IUPAC name is butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;1-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]-3-prop-2-enoxypropan-2-ol.
| Compound Name | butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;1-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 91532506 |
| Molecular Formula | C26H58O9Si3 |
| Molecular Weight | 599.00 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;1-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)COCC(O)COCC(O)COCC=C.CCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H28O7.C11H30O2Si3/c1-3-5-19-7-13(16)9-21-11-15(18)12-22-10-14(17)8-20-6-4-2;1-9-10-11-15(5,6)13-16(7,8)12-14(2,3)4/h3-4,13-18H,1-2,5-12H2;9-11H2,1-8H3 |
| InChIKey | YUSWAIGSCZKSCN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.00 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|