C12H24O7 — CID 54120900
3-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]propane-1,2-diol (PubChem CID 54120900) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]propane-1,2-diol.
| Compound Name | 3-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 54120900 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[2-hydroxy-3-(2-hydroxy-3-prop-2-enoxypropoxy)propoxy]propane-1,2-diol |
| SMILES | C=CCOCC(O)COCC(O)COCC(O)CO |
| InChI | InChI=1S/C12H24O7/c1-2-3-17-6-11(15)7-19-9-12(16)8-18-5-10(14)4-13/h2,10-16H,1,3-9H2 |
| InChIKey | NNPZKFPTAHQFTE-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|