C6H12Cl6O5P2 — CID 174422738
bis(phosphoryl trichloride);3-prop-2-enoxypropane-1,2-diol (PubChem CID 174422738) has the molecular formula C6H12Cl6O5P2 and a molecular weight of 438.82 g/mol. Its IUPAC name is bis(phosphoryl trichloride);3-prop-2-enoxypropane-1,2-diol.
| Compound Name | bis(phosphoryl trichloride);3-prop-2-enoxypropane-1,2-diol |
|---|---|
| PubChem CID | 174422738 |
| Molecular Formula | C6H12Cl6O5P2 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 435.83 |
| IUPAC Name | bis(phosphoryl trichloride);3-prop-2-enoxypropane-1,2-diol |
| SMILES | C=CCOCC(O)CO.O=P(Cl)(Cl)Cl.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H12O3.2Cl3OP/c1-2-3-9-5-6(8)4-7;2*1-5(2,3)4/h2,6-8H,1,3-5H2;; |
| InChIKey | OWHVDYLDGCHWKH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|