C14H32O8S — CID 6455521
2-(2-hydroxyethoxy)ethanol;2-(2-hydroxyethylsulfanyl)ethanol;3-prop-2-enoxypropane-1,2-diol (PubChem CID 6455521) has the molecular formula C14H32O8S and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;2-(2-hydroxyethylsulfanyl)ethanol;3-prop-2-enoxypropane-1,2-diol.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;2-(2-hydroxyethylsulfanyl)ethanol;3-prop-2-enoxypropane-1,2-diol |
|---|---|
| PubChem CID | 6455521 |
| Molecular Formula | C14H32O8S |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;2-(2-hydroxyethylsulfanyl)ethanol;3-prop-2-enoxypropane-1,2-diol |
| SMILES | C=CCOCC(O)CO.OCCOCCO.OCCSCCO |
| InChI | InChI=1S/C6H12O3.C4H10O3.C4H10O2S/c1-2-3-9-5-6(8)4-7;2*5-1-3-7-4-2-6/h2,6-8H,1,3-5H2;2*5-6H,1-4H2 |
| InChIKey | PHDAYALFAKWKBR-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|