C15H28O7 — CID 88980935
3-[1-(2-hydroxy-3-prop-2-enoxypropoxy)-3-prop-2-enoxypropan-2-yl]oxypropane-1,2-diol (PubChem CID 88980935) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is 3-[1-(2-hydroxy-3-prop-2-enoxypropoxy)-3-prop-2-enoxypropan-2-yl]oxypropane-1,2-diol.
| Compound Name | 3-[1-(2-hydroxy-3-prop-2-enoxypropoxy)-3-prop-2-enoxypropan-2-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 88980935 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-[1-(2-hydroxy-3-prop-2-enoxypropoxy)-3-prop-2-enoxypropan-2-yl]oxypropane-1,2-diol |
| SMILES | C=CCOCC(O)COCC(COCC=C)OCC(O)CO |
| InChI | InChI=1S/C15H28O7/c1-3-5-19-8-14(18)9-21-12-15(11-20-6-4-2)22-10-13(17)7-16/h3-4,13-18H,1-2,5-12H2 |
| InChIKey | GJNOATPNCMYYRR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|