C19H39O10P — CID 162088918
2-[2-(2,3-dihydroxypropoxy)-3-[1-(3-methylbutoxy)-3-prop-2-enoxypropan-2-yl]oxypropoxy]ethylphosphonic acid (PubChem CID 162088918) has the molecular formula C19H39O10P and a molecular weight of 458.49 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroxypropoxy)-3-[1-(3-methylbutoxy)-3-prop-2-enoxypropan-2-yl]oxypropoxy]ethylphosphonic acid.
| Compound Name | 2-[2-(2,3-dihydroxypropoxy)-3-[1-(3-methylbutoxy)-3-prop-2-enoxypropan-2-yl]oxypropoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 162088918 |
| Molecular Formula | C19H39O10P |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-[2-(2,3-dihydroxypropoxy)-3-[1-(3-methylbutoxy)-3-prop-2-enoxypropan-2-yl]oxypropoxy]ethylphosphonic acid |
| SMILES | C=CCOCC(COCCC(C)C)OCC(COCCP(=O)(O)O)OCC(O)CO |
| InChI | InChI=1S/C19H39O10P/c1-4-6-25-12-18(13-26-7-5-16(2)3)29-15-19(28-11-17(21)10-20)14-27-8-9-30(22,23)24/h4,16-21H,1,5-15H2,2-3H3,(H2,22,23,24) |
| InChIKey | HUQGVDGHGNGFOB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|