C10H22O3 — CID 174750448
ethane-1,2-diol;3-methyl-1-prop-2-enoxybutane (PubChem CID 174750448) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is ethane-1,2-diol;3-methyl-1-prop-2-enoxybutane.
| Compound Name | ethane-1,2-diol;3-methyl-1-prop-2-enoxybutane |
|---|---|
| PubChem CID | 174750448 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | ethane-1,2-diol;3-methyl-1-prop-2-enoxybutane |
| SMILES | C=CCOCCC(C)C.OCCO |
| InChI | InChI=1S/C8H16O.C2H6O2/c1-4-6-9-7-5-8(2)3;3-1-2-4/h4,8H,1,5-7H2,2-3H3;3-4H,1-2H2 |
| InChIKey | FFUZOMZAAIMQEN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|