About 3-methoxyprop-1-ene;3-methylbutan-1-ol
3-methoxyprop-1-ene;3-methylbutan-1-ol (PubChem CID 87580492) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-methoxyprop-1-ene;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 3-methoxyprop-1-ene;3-methylbutan-1-ol |
| PubChem CID | 87580492 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 3-methoxyprop-1-ene;3-methylbutan-1-ol |
| SMILES | C=CCOC.CC(C)CCO |
| InChI | InChI=1S/C5H12O.C4H8O/c1-5(2)3-4-6;1-3-4-5-2/h5-6H,3-4H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | CBUHDVOUMUTSCO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyprop-1-ene;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyprop-1-ene;3-methylbutan-1-ol?
The IUPAC name of 3-methoxyprop-1-ene;3-methylbutan-1-ol (CID 87580492) is 3-methoxyprop-1-ene;3-methylbutan-1-ol.
What is the SMILES notation for 3-methoxyprop-1-ene;3-methylbutan-1-ol?
The canonical SMILES for 3-methoxyprop-1-ene;3-methylbutan-1-ol is C=CCOC.CC(C)CCO.
What is the InChIKey of 3-methoxyprop-1-ene;3-methylbutan-1-ol?
The InChIKey is CBUHDVOUMUTSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C4H8O/c1-5(2)3-4-6;1-3-4-5-2/h5-6H,3-4H2,1-2H3;3H,1,4H2,2H3.
What are the key properties of 3-methoxyprop-1-ene;3-methylbutan-1-ol?
3-methoxyprop-1-ene;3-methylbutan-1-ol has a molecular weight of 160.26 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyprop-1-ene;3-methylbutan-1-ol is sourced from PubChem (CID 87580492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).