About formyl chloride;3-methylbutan-1-ol
formyl chloride;3-methylbutan-1-ol (PubChem CID 88598720) has the molecular formula C6H13ClO2
and a molecular weight of 152.62 g/mol. Its IUPAC name is formyl chloride;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | formyl chloride;3-methylbutan-1-ol |
| PubChem CID | 88598720 |
| Molecular Formula | C6H13ClO2 |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | formyl chloride;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.O=CCl |
| InChI | InChI=1S/C5H12O.CHClO/c1-5(2)3-4-6;2-1-3/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | WSVZLRLRAAWKLT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formyl chloride;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl chloride;3-methylbutan-1-ol?
The IUPAC name of formyl chloride;3-methylbutan-1-ol (CID 88598720) is formyl chloride;3-methylbutan-1-ol.
What is the SMILES notation for formyl chloride;3-methylbutan-1-ol?
The canonical SMILES for formyl chloride;3-methylbutan-1-ol is CC(C)CCO.O=CCl.
What is the InChIKey of formyl chloride;3-methylbutan-1-ol?
The InChIKey is WSVZLRLRAAWKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.CHClO/c1-5(2)3-4-6;2-1-3/h5-6H,3-4H2,1-2H3;1H.
What are the key properties of formyl chloride;3-methylbutan-1-ol?
formyl chloride;3-methylbutan-1-ol has a molecular weight of 152.62 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formyl chloride;3-methylbutan-1-ol is sourced from PubChem (CID 88598720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).