About (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol
(Z)-N-formylbut-2-enamide;3-methylbutan-1-ol (PubChem CID 171813190) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol |
| PubChem CID | 171813190 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol |
| SMILES | C/C=C\C(=O)NC=O.CC(C)CCO |
| InChI | InChI=1S/C5H7NO2.C5H12O/c1-2-3-5(8)6-4-7;1-5(2)3-4-6/h2-4H,1H3,(H,6,7,8);5-6H,3-4H2,1-2H3/b3-2-; |
| InChIKey | YTGVWXKBZJKJFO-OLGQORCHSA-N |
| XLogP | 0.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol?
The IUPAC name of (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol (CID 171813190) is (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol.
What is the SMILES notation for (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol?
The canonical SMILES for (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol is C/C=C\C(=O)NC=O.CC(C)CCO.
What is the InChIKey of (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol?
The InChIKey is YTGVWXKBZJKJFO-OLGQORCHSA-N. The full InChI is InChI=1S/C5H7NO2.C5H12O/c1-2-3-5(8)6-4-7;1-5(2)3-4-6/h2-4H,1H3,(H,6,7,8);5-6H,3-4H2,1-2H3/b3-2-;.
What are the key properties of (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol?
(Z)-N-formylbut-2-enamide;3-methylbutan-1-ol has a molecular weight of 201.27 g/mol, XLogP of 0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-formylbut-2-enamide;3-methylbutan-1-ol is sourced from PubChem (CID 171813190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).