About propane;(E)-N-propan-2-ylbut-2-enamide
propane;(E)-N-propan-2-ylbut-2-enamide (PubChem CID 177014610) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is propane;(E)-N-propan-2-ylbut-2-enamide.
Molecular Properties
| Compound Name | propane;(E)-N-propan-2-ylbut-2-enamide |
| PubChem CID | 177014610 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | propane;(E)-N-propan-2-ylbut-2-enamide |
| SMILES | C/C=C/C(=O)NC(C)C.CCC |
| InChI | InChI=1S/C7H13NO.C3H8/c1-4-5-7(9)8-6(2)3;1-3-2/h4-6H,1-3H3,(H,8,9);3H2,1-2H3/b5-4+; |
| InChIKey | UEGASHLAKMDMFU-FXRZFVDSSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propane;(E)-N-propan-2-ylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;(E)-N-propan-2-ylbut-2-enamide?
The IUPAC name of propane;(E)-N-propan-2-ylbut-2-enamide (CID 177014610) is propane;(E)-N-propan-2-ylbut-2-enamide.
What is the SMILES notation for propane;(E)-N-propan-2-ylbut-2-enamide?
The canonical SMILES for propane;(E)-N-propan-2-ylbut-2-enamide is C/C=C/C(=O)NC(C)C.CCC.
What is the InChIKey of propane;(E)-N-propan-2-ylbut-2-enamide?
The InChIKey is UEGASHLAKMDMFU-FXRZFVDSSA-N. The full InChI is InChI=1S/C7H13NO.C3H8/c1-4-5-7(9)8-6(2)3;1-3-2/h4-6H,1-3H3,(H,8,9);3H2,1-2H3/b5-4+;.
What are the key properties of propane;(E)-N-propan-2-ylbut-2-enamide?
propane;(E)-N-propan-2-ylbut-2-enamide has a molecular weight of 171.28 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;(E)-N-propan-2-ylbut-2-enamide is sourced from PubChem (CID 177014610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).