C10H17NO — CID 76545623
N-butan-2-ylhexa-2,4-dienamide (PubChem CID 76545623) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N-butan-2-ylhexa-2,4-dienamide.
| Compound Name | N-butan-2-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 76545623 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-butan-2-ylhexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NC(C)CC |
| InChI | InChI=1S/C10H17NO/c1-4-6-7-8-10(12)11-9(3)5-2/h4,6-9H,5H2,1-3H3,(H,11,12) |
| InChIKey | SMNBNLTXGHBZMK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|