(2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid

C12H19NO3 — CID 61132393

IUPAC(2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid
SMILESCC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)CC
InChIInChI=1S/C12H19NO3/c1-4-6-7-8-10(14)13-11(12(15)16)9(3)5-2/h4,6-9,11H,5H2,1-3H3,(H,13,14)(H,15,16)/t9-,11-/m0/s1
InChIKeyXXMJBUOPOHNCOM-ONGXEEELSA-N
MW225.29 g/mol
LogP1.73
Rot. Bonds6

About (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid

(2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid (PubChem CID 61132393) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid.

Molecular Properties

Compound Name(2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid
PubChem CID61132393
Molecular FormulaC12H19NO3
Molecular Weight225.29 g/mol
Exact Mass225.14
IUPAC Name(2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid
SMILESCC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)CC
InChIInChI=1S/C12H19NO3/c1-4-6-7-8-10(14)13-11(12(15)16)9(3)5-2/h4,6-9,11H,5H2,1-3H3,(H,13,14)(H,15,16)/t9-,11-/m0/s1
InChIKeyXXMJBUOPOHNCOM-ONGXEEELSA-N
XLogP1.73
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.29
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid?
The IUPAC name of (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid (CID 61132393) is (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid.
What is the SMILES notation for (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid?
The canonical SMILES for (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid is CC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)CC.
What is the InChIKey of (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid?
The InChIKey is XXMJBUOPOHNCOM-ONGXEEELSA-N. The full InChI is InChI=1S/C12H19NO3/c1-4-6-7-8-10(14)13-11(12(15)16)9(3)5-2/h4,6-9,11H,5H2,1-3H3,(H,13,14)(H,15,16)/t9-,11-/m0/s1.
What are the key properties of (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid?
(2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid has a molecular weight of 225.29 g/mol, XLogP of 1.73, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(hexa-2,4-dienoylamino)-3-methylpentanoic acid is sourced from PubChem (CID 61132393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).