C13H19NO5 — CID 107039208
(2S)-5-ethoxy-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-oxopentanoic acid (PubChem CID 107039208) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-5-ethoxy-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-ethoxy-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107039208 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (2S)-5-ethoxy-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-oxopentanoic acid |
| SMILES | CC=C/C=C/C(=O)N[C@@H](CCC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C13H19NO5/c1-3-5-6-7-11(15)14-10(13(17)18)8-9-12(16)19-4-2/h3,5-7,10H,4,8-9H2,1-2H3,(H,14,15)(H,17,18)/b5-3?,7-6+/t10-/m0/s1 |
| InChIKey | CRISOIPQLBLAMA-UBHLUTBCSA-N |
| XLogP | 1.03 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|