C12H17NO5 — CID 114004624
(2S)-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 114004624) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2S)-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 114004624 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2S)-2-[[(2E)-hexa-2,4-dienoyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | CC=C/C=C/C(=O)N[C@@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C12H17NO5/c1-3-4-5-6-10(14)13-9(12(16)17)7-8-11(15)18-2/h3-6,9H,7-8H2,1-2H3,(H,13,14)(H,16,17)/b4-3?,6-5+/t9-/m0/s1 |
| InChIKey | MIDCJRSRSMBLCI-GVZAIWAMSA-N |
| XLogP | 0.64 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|