(2S)-2-(hexa-2,4-dienoylamino)butanedioic acid

C10H13NO5 — CID 114287498

IUPAC(2S)-2-(hexa-2,4-dienoylamino)butanedioic acid
SMILESCC=CC=CC(=O)N[C@@H](CC(=O)O)C(=O)O
InChIInChI=1S/C10H13NO5/c1-2-3-4-5-8(12)11-7(10(15)16)6-9(13)14/h2-5,7H,6H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1
InChIKeyGAUUQJNWHVTFRB-ZETCQYMHSA-N
MW227.22 g/mol
LogP0.16
Rot. Bonds6

About (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid

(2S)-2-(hexa-2,4-dienoylamino)butanedioic acid (PubChem CID 114287498) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid.

Molecular Properties

Compound Name(2S)-2-(hexa-2,4-dienoylamino)butanedioic acid
PubChem CID114287498
Molecular FormulaC10H13NO5
Molecular Weight227.22 g/mol
Exact Mass227.08
IUPAC Name(2S)-2-(hexa-2,4-dienoylamino)butanedioic acid
SMILESCC=CC=CC(=O)N[C@@H](CC(=O)O)C(=O)O
InChIInChI=1S/C10H13NO5/c1-2-3-4-5-8(12)11-7(10(15)16)6-9(13)14/h2-5,7H,6H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1
InChIKeyGAUUQJNWHVTFRB-ZETCQYMHSA-N
XLogP0.16
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 50.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid?
The IUPAC name of (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid (CID 114287498) is (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid.
What is the SMILES notation for (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid?
The canonical SMILES for (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid is CC=CC=CC(=O)N[C@@H](CC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid?
The InChIKey is GAUUQJNWHVTFRB-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H13NO5/c1-2-3-4-5-8(12)11-7(10(15)16)6-9(13)14/h2-5,7H,6H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1.
What are the key properties of (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid?
(2S)-2-(hexa-2,4-dienoylamino)butanedioic acid has a molecular weight of 227.22 g/mol, XLogP of 0.16, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(hexa-2,4-dienoylamino)butanedioic acid is sourced from PubChem (CID 114287498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).