C7H11NO3S — CID 175605206
2-(but-2-enoylamino)-3-sulfanylpropanoic acid (PubChem CID 175605206) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 2-(but-2-enoylamino)-3-sulfanylpropanoic acid.
| Compound Name | 2-(but-2-enoylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175605206 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 2-(but-2-enoylamino)-3-sulfanylpropanoic acid |
| SMILES | CC=CC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C7H11NO3S/c1-2-3-6(9)8-5(4-12)7(10)11/h2-3,5,12H,4H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | JPNPGEQETQFUDA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|