C8H13NO3S — CID 58349001
methyl 2-[[(E)-but-2-enoyl]amino]-3-sulfanylpropanoate (PubChem CID 58349001) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is methyl 2-[[(E)-but-2-enoyl]amino]-3-sulfanylpropanoate.
| Compound Name | methyl 2-[[(E)-but-2-enoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 58349001 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | methyl 2-[[(E)-but-2-enoyl]amino]-3-sulfanylpropanoate |
| SMILES | C/C=C/C(=O)NC(CS)C(=O)OC |
| InChI | InChI=1S/C8H13NO3S/c1-3-4-7(10)9-6(5-13)8(11)12-2/h3-4,6,13H,5H2,1-2H3,(H,9,10)/b4-3+ |
| InChIKey | PFEWARGMLMIGOT-ONEGZZNKSA-N |
| XLogP | 0.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|