C14H24N2O5 — CID 58348985
methyl 2-[[(E)-but-2-enoyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 58348985) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 2-[[(E)-but-2-enoyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 2-[[(E)-but-2-enoyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 58348985 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | methyl 2-[[(E)-but-2-enoyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C/C=C/C(=O)NC(CCNC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H24N2O5/c1-6-7-11(17)16-10(12(18)20-5)8-9-15-13(19)21-14(2,3)4/h6-7,10H,8-9H2,1-5H3,(H,15,19)(H,16,17)/b7-6+ |
| InChIKey | KAGFHAXZFDKZOI-VOTSOKGWSA-N |
| XLogP | 1.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|