C20H28N2O5 — CID 175537152
methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-phenylprop-2-enoylamino)pentanoate (PubChem CID 175537152) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-phenylprop-2-enoylamino)pentanoate.
| Compound Name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-phenylprop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 175537152 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-phenylprop-2-enoylamino)pentanoate |
| SMILES | COC(=O)C(CCCNC(=O)OC(C)(C)C)NC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C20H28N2O5/c1-20(2,3)27-19(25)21-14-8-11-16(18(24)26-4)22-17(23)13-12-15-9-6-5-7-10-15/h5-7,9-10,12-13,16H,8,11,14H2,1-4H3,(H,21,25)(H,22,23) |
| InChIKey | LYJOHYACLRCPHO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|