C31H36N2O5 — CID 59774953
methyl (2S)-2-[(3-benzhydrylbenzoyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 59774953) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is methyl (2S)-2-[(3-benzhydrylbenzoyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl (2S)-2-[(3-benzhydrylbenzoyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 59774953 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | methyl (2S)-2-[(3-benzhydrylbenzoyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)[C@H](CCCNC(=O)OC(C)(C)C)NC(=O)c1cccc(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H36N2O5/c1-31(2,3)38-30(36)32-20-12-19-26(29(35)37-4)33-28(34)25-18-11-17-24(21-25)27(22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-11,13-18,21,26-27H,12,19-20H2,1-4H3,(H,32,36)(H,33,34)/t26-/m0/s1 |
| InChIKey | SNJZNTCEAQYTME-SANMLTNESA-N |
| XLogP | 5.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|