C17H25N3O5 — CID 155140357
methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(pyridine-3-carbonylamino)pentanoate (PubChem CID 155140357) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(pyridine-3-carbonylamino)pentanoate.
| Compound Name | methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(pyridine-3-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 155140357 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | methyl (2S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(pyridine-3-carbonylamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCNC(=O)OC(C)(C)C)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C17H25N3O5/c1-17(2,3)25-16(23)19-10-6-8-13(15(22)24-4)20-14(21)12-7-5-9-18-11-12/h5,7,9,11,13H,6,8,10H2,1-4H3,(H,19,23)(H,20,21)/t13-/m0/s1 |
| InChIKey | BVBOZMHJGDZVHG-ZDUSSCGKSA-N |
| XLogP | 1.66 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|