C14H18N2O4S — CID 54245097
(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(pyridine-3-carbonylamino)butanethioic S-acid (PubChem CID 54245097) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(pyridine-3-carbonylamino)butanethioic S-acid.
| Compound Name | (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(pyridine-3-carbonylamino)butanethioic S-acid |
|---|---|
| PubChem CID | 54245097 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(pyridine-3-carbonylamino)butanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)C[C@@H](NC(=O)c1cccnc1)C(=O)S |
| InChI | InChI=1S/C14H18N2O4S/c1-14(2,3)20-11(17)7-10(13(19)21)16-12(18)9-5-4-6-15-8-9/h4-6,8,10H,7H2,1-3H3,(H,16,18)(H,19,21)/t10-/m1/s1 |
| InChIKey | QSSCAYSMUUMZJO-SNVBAGLBSA-N |
| XLogP | 1.37 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|