C26H35F6N5O7 — CID 155140365
tert-butyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-oxo-4-(pyridine-3-carbonylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 155140365) has the molecular formula C26H35F6N5O7 and a molecular weight of 643.58 g/mol. Its IUPAC name is tert-butyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-oxo-4-(pyridine-3-carbonylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-oxo-4-(pyridine-3-carbonylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 155140365 |
| Molecular Formula | C26H35F6N5O7 |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | tert-butyl N-[N'-[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-oxo-4-(pyridine-3-carbonylamino)hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC(NC(=O)c1cccnc1)C(=O)COC(C(F)(F)F)C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35F6N5O7/c1-23(2,3)43-21(40)36-20(37-22(41)44-24(4,5)6)34-12-8-10-16(35-18(39)15-9-7-11-33-13-15)17(38)14-42-19(25(27,28)29)26(30,31)32/h7,9,11,13,16,19H,8,10,12,14H2,1-6H3,(H,35,39)(H2,34,36,37,40,41) |
| InChIKey | POEVWHDKPAXLDC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 157.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|