C19H25F2N3O3 — CID 142307575
N-[7-amino-1-[(2Z,4E)-2,4-difluorohexa-2,4-dien-3-yl]oxy-2-oxoheptan-3-yl]pyridine-3-carboxamide (PubChem CID 142307575) has the molecular formula C19H25F2N3O3 and a molecular weight of 381.42 g/mol. Its IUPAC name is N-[7-amino-1-[(2Z,4E)-2,4-difluorohexa-2,4-dien-3-yl]oxy-2-oxoheptan-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[7-amino-1-[(2Z,4E)-2,4-difluorohexa-2,4-dien-3-yl]oxy-2-oxoheptan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142307575 |
| Molecular Formula | C19H25F2N3O3 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[7-amino-1-[(2Z,4E)-2,4-difluorohexa-2,4-dien-3-yl]oxy-2-oxoheptan-3-yl]pyridine-3-carboxamide |
| SMILES | C/C=C(F)\C(OCC(=O)C(CCCCN)NC(=O)c1cccnc1)=C(/C)F |
| InChI | InChI=1S/C19H25F2N3O3/c1-3-15(21)18(13(2)20)27-12-17(25)16(8-4-5-9-22)24-19(26)14-7-6-10-23-11-14/h3,6-7,10-11,16H,4-5,8-9,12,22H2,1-2H3,(H,24,26)/b15-3+,18-13- |
| InChIKey | WLCUSWBHIAXKLO-ZRPAMRBDSA-N |
| XLogP | 2.97 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|