C20H23F2N3O3 — CID 158713062
N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]pyridine-3-carboxamide (PubChem CID 158713062) has the molecular formula C20H23F2N3O3 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158713062 |
| Molecular Formula | C20H23F2N3O3 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[7-amino-1-(2,6-difluoro-3-methylphenoxy)-2-oxoheptan-3-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(F)c(OCC(=O)C(CCCCN)NC(=O)c2cccnc2)c1F |
| InChI | InChI=1S/C20H23F2N3O3/c1-13-7-8-15(21)19(18(13)22)28-12-17(26)16(6-2-3-9-23)25-20(27)14-5-4-10-24-11-14/h4-5,7-8,10-11,16H,2-3,6,9,12,23H2,1H3,(H,25,27) |
| InChIKey | JUUOPKPIHPZVTK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|