About N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide
N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide (PubChem CID 134347945) has the molecular formula C19H20BrF2N3O3
and a molecular weight of 456.29 g/mol. Its IUPAC name is N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide |
| PubChem CID | 134347945 |
| Molecular Formula | C19H20BrF2N3O3 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)c1cccnc1Br)C(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C19H20BrF2N3O3/c20-18-12(5-4-10-24-18)19(27)25-15(8-1-2-9-23)16(26)11-28-17-13(21)6-3-7-14(17)22/h3-7,10,15H,1-2,8-9,11,23H2,(H,25,27)/t15-/m0/s1 |
| InChIKey | NOROPRGQKYUUNU-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide?
The IUPAC name of N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide (CID 134347945) is N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide.
What is the SMILES notation for N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide?
The canonical SMILES for N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide is NCCCC[C@H](NC(=O)c1cccnc1Br)C(=O)COc1c(F)cccc1F.
What is the InChIKey of N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide?
The InChIKey is NOROPRGQKYUUNU-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H20BrF2N3O3/c20-18-12(5-4-10-24-18)19(27)25-15(8-1-2-9-23)16(26)11-28-17-13(21)6-3-7-14(17)22/h3-7,10,15H,1-2,8-9,11,23H2,(H,25,27)/t15-/m0/s1.
What are the key properties of N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide?
N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide has a molecular weight of 456.29 g/mol, XLogP of 3.00, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]-2-bromopyridine-3-carboxamide is sourced from PubChem (CID 134347945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).