C28H31F2N5O4 — CID 142307555
3-amino-N-[7-amino-1-[4-[[(4-aminobenzoyl)amino]methyl]-2,6-difluorophenoxy]-2-oxoheptan-3-yl]benzamide (PubChem CID 142307555) has the molecular formula C28H31F2N5O4 and a molecular weight of 539.58 g/mol. Its IUPAC name is 3-amino-N-[7-amino-1-[4-[[(4-aminobenzoyl)amino]methyl]-2,6-difluorophenoxy]-2-oxoheptan-3-yl]benzamide.
| Compound Name | 3-amino-N-[7-amino-1-[4-[[(4-aminobenzoyl)amino]methyl]-2,6-difluorophenoxy]-2-oxoheptan-3-yl]benzamide |
|---|---|
| PubChem CID | 142307555 |
| Molecular Formula | C28H31F2N5O4 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 3-amino-N-[7-amino-1-[4-[[(4-aminobenzoyl)amino]methyl]-2,6-difluorophenoxy]-2-oxoheptan-3-yl]benzamide |
| SMILES | NCCCCC(NC(=O)c1cccc(N)c1)C(=O)COc1c(F)cc(CNC(=O)c2ccc(N)cc2)cc1F |
| InChI | InChI=1S/C28H31F2N5O4/c29-22-12-17(15-34-27(37)18-7-9-20(32)10-8-18)13-23(30)26(22)39-16-25(36)24(6-1-2-11-31)35-28(38)19-4-3-5-21(33)14-19/h3-5,7-10,12-14,24H,1-2,6,11,15-16,31-33H2,(H,34,37)(H,35,38) |
| InChIKey | UGEIQAXXTJTVEP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|