C20H21F4N3O3 — CID 145061370
3-amino-N-[7-amino-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)heptan-3-yl]benzamide (PubChem CID 145061370) has the molecular formula C20H21F4N3O3 and a molecular weight of 427.40 g/mol. Its IUPAC name is 3-amino-N-[7-amino-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)heptan-3-yl]benzamide.
| Compound Name | 3-amino-N-[7-amino-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)heptan-3-yl]benzamide |
|---|---|
| PubChem CID | 145061370 |
| Molecular Formula | C20H21F4N3O3 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-amino-N-[7-amino-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)heptan-3-yl]benzamide |
| SMILES | NCCCCC(NC(=O)c1cccc(N)c1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C20H21F4N3O3/c21-13-9-14(22)18(24)19(17(13)23)30-10-16(28)15(6-1-2-7-25)27-20(29)11-4-3-5-12(26)8-11/h3-5,8-9,15H,1-2,6-7,10,25-26H2,(H,27,29) |
| InChIKey | DBRBOWQUUKRSLV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|