About N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide
N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide (PubChem CID 134347937) has the molecular formula C19H26F2N2O3
and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
| PubChem CID | 134347937 |
| Molecular Formula | C19H26F2N2O3 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide |
| SMILES | NCCCCC(NC(=O)C1CCCC1)C(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C19H26F2N2O3/c20-14-8-5-9-15(21)18(14)26-12-17(24)16(10-3-4-11-22)23-19(25)13-6-1-2-7-13/h5,8-9,13,16H,1-4,6-7,10-12,22H2,(H,23,25) |
| InChIKey | DOHXJAQSKHNDLH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide?
The IUPAC name of N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide (CID 134347937) is N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide.
What is the SMILES notation for N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide?
The canonical SMILES for N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide is NCCCCC(NC(=O)C1CCCC1)C(=O)COc1c(F)cccc1F.
What is the InChIKey of N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide?
The InChIKey is DOHXJAQSKHNDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26F2N2O3/c20-14-8-5-9-15(21)18(14)26-12-17(24)16(10-3-4-11-22)23-19(25)13-6-1-2-7-13/h5,8-9,13,16H,1-4,6-7,10-12,22H2,(H,23,25).
What are the key properties of N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide?
N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide has a molecular weight of 368.42 g/mol, XLogP of 2.72, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-amino-1-(2,6-difluorophenoxy)-2-oxoheptan-3-yl]cyclopentanecarboxamide is sourced from PubChem (CID 134347937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).