About N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide
N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide (PubChem CID 121266148) has the molecular formula C15H23N3O2S
and a molecular weight of 309.44 g/mol. Its IUPAC name is N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide |
| PubChem CID | 121266148 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide |
| SMILES | NCCCCC(NC(=O)C1CCCC1)C(=O)c1nccs1 |
| InChI | InChI=1S/C15H23N3O2S/c16-8-4-3-7-12(13(19)15-17-9-10-21-15)18-14(20)11-5-1-2-6-11/h9-12H,1-8,16H2,(H,18,20) |
| InChIKey | LINJWDQYDVHDDC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide?
The IUPAC name of N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide (CID 121266148) is N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide.
What is the SMILES notation for N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide?
The canonical SMILES for N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide is NCCCCC(NC(=O)C1CCCC1)C(=O)c1nccs1.
What is the InChIKey of N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide?
The InChIKey is LINJWDQYDVHDDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2S/c16-8-4-3-7-12(13(19)15-17-9-10-21-15)18-14(20)11-5-1-2-6-11/h9-12H,1-8,16H2,(H,18,20).
What are the key properties of N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide?
N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide has a molecular weight of 309.44 g/mol, XLogP of 2.13, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]cyclopentanecarboxamide is sourced from PubChem (CID 121266148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).