C16H24N6O4S — CID 22888583
1-acetyl-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 22888583) has the molecular formula C16H24N6O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-acetyl-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22888583 |
| Molecular Formula | C16H24N6O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-acetyl-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CC(O)CC1C(=O)NC(CCCN=C(N)N)C(=O)c1nccs1 |
| InChI | InChI=1S/C16H24N6O4S/c1-9(23)22-8-10(24)7-12(22)14(26)21-11(3-2-4-20-16(17)18)13(25)15-19-5-6-27-15/h5-6,10-12,24H,2-4,7-8H2,1H3,(H,21,26)(H4,17,18,20) |
| InChIKey | FOGVEVTZPZCRAO-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|