C24H30N6O3S2 — CID 147495584
(3R,8aS)-N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-6-benzyl-5-oxo-3,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-c]pyrimidine-3-carboxamide (PubChem CID 147495584) has the molecular formula C24H30N6O3S2 and a molecular weight of 514.68 g/mol. Its IUPAC name is (3R,8aS)-N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-6-benzyl-5-oxo-3,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-c]pyrimidine-3-carboxamide.
| Compound Name | (3R,8aS)-N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-6-benzyl-5-oxo-3,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-c]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 147495584 |
| Molecular Formula | C24H30N6O3S2 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (3R,8aS)-N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-6-benzyl-5-oxo-3,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-c]pyrimidine-3-carboxamide |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)[C@@H]1CS[C@H]2CCN(Cc3ccccc3)C(=O)N21)C(=O)c1nccs1 |
| InChI | InChI=1S/C24H30N6O3S2/c1-16(25)26-10-5-8-18(21(31)23-27-11-13-34-23)28-22(32)19-15-35-20-9-12-29(24(33)30(19)20)14-17-6-3-2-4-7-17/h2-4,6-7,11,13,18-20H,5,8-10,12,14-15H2,1H3,(H2,25,26)(H,28,32)/t18-,19-,20-/m0/s1 |
| InChIKey | FGJOZQNPGDQCPZ-UFYCRDLUSA-N |
| XLogP | 2.74 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|