C26H29N7O3S2 — CID 139797347
(3S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-6-benzyl-5-oxo-2,3,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3-carboxamide (PubChem CID 139797347) has the molecular formula C26H29N7O3S2 and a molecular weight of 551.70 g/mol. Its IUPAC name is (3S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-6-benzyl-5-oxo-2,3,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-6-benzyl-5-oxo-2,3,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 139797347 |
| Molecular Formula | C26H29N7O3S2 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | (3S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-6-benzyl-5-oxo-2,3,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3-carboxamide |
| SMILES | NC(N)=NCCCC(NC(=O)[C@H]1CSC2CN(Cc3ccccc3)C(=O)N21)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H29N7O3S2/c27-25(28)29-12-6-10-18(22(34)24-31-17-9-4-5-11-20(17)38-24)30-23(35)19-15-37-21-14-32(26(36)33(19)21)13-16-7-2-1-3-8-16/h1-5,7-9,11,18-19,21H,6,10,12-15H2,(H,30,35)(H4,27,28,29)/t18?,19-,21?/m1/s1 |
| InChIKey | BRCUBIICFQZRIT-OBXNSHGQSA-N |
| XLogP | 2.40 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|