C18H23AcN6O3S- — CID 160864758
actinium;(2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide;molecular hydrogen (PubChem CID 160864758) has the molecular formula C18H23AcN6O3S- and a molecular weight of 630.49 g/mol. Its IUPAC name is actinium;(2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide;molecular hydrogen.
| Compound Name | actinium;(2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 160864758 |
| Molecular Formula | C18H23AcN6O3S- |
| Molecular Weight | 630.49 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | actinium;(2S)-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide;molecular hydrogen |
| SMILES | NC(N)=NCCCC(NC(=O)[C@@H]1CC(=O)C[N-]1)C(=O)c1nc2ccccc2s1.[Ac].[H][H] |
| InChI | InChI=1S/C18H21N6O3S.Ac.H2/c19-18(20)21-7-3-5-12(23-16(27)13-8-10(25)9-22-13)15(26)17-24-11-4-1-2-6-14(11)28-17;;/h1-2,4,6,12-13H,3,5,7-9H2,(H,23,27)(H4,19,20,21);;1H/q-1;;/t12?,13-;;/m0../s1 |
| InChIKey | IGSCMPLMPFRKQM-RIWFDJIXSA-N |
| XLogP | 0.98 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|