C19H22AcN5O3S- — CID 58735051
actinium;(2S)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide (PubChem CID 58735051) has the molecular formula C19H22AcN5O3S- and a molecular weight of 627.48 g/mol. Its IUPAC name is actinium;(2S)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide.
| Compound Name | actinium;(2S)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide |
|---|---|
| PubChem CID | 58735051 |
| Molecular Formula | C19H22AcN5O3S- |
| Molecular Weight | 627.48 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | actinium;(2S)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-oxopentan-2-yl]-4-oxopyrrolidin-1-ide-2-carboxamide |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)[C@@H]1CC(=O)C[N-]1)C(=O)c1nc2ccccc2s1.[Ac] |
| InChI | InChI=1S/C19H22N5O3S.Ac/c1-11(20)21-8-4-6-14(23-18(27)15-9-12(25)10-22-15)17(26)19-24-13-5-2-3-7-16(13)28-19;/h2-3,5,7,14-15H,4,6,8-10H2,1H3,(H2,20,21)(H,23,27);/q-1;/t14-,15-;/m0./s1 |
| InChIKey | QCYSEZNGQDAGNC-YYLIZZNMSA-N |
| XLogP | 1.84 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|