C28H33N7O3S2 — CID 54510569
3-amino-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazine-6-carboxamide (PubChem CID 54510569) has the molecular formula C28H33N7O3S2 and a molecular weight of 579.75 g/mol. Its IUPAC name is 3-amino-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazine-6-carboxamide.
| Compound Name | 3-amino-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazine-6-carboxamide |
|---|---|
| PubChem CID | 54510569 |
| Molecular Formula | C28H33N7O3S2 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 3-amino-N-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-benzyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]thiazine-6-carboxamide |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCC2SC(Cc3ccccc3)C(N)C(=O)N21)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H33N7O3S2/c29-23-21(15-16-7-2-1-3-8-16)39-22-13-12-19(35(22)27(23)38)25(37)33-18(10-6-14-32-28(30)31)24(36)26-34-17-9-4-5-11-20(17)40-26/h1-5,7-9,11,18-19,21-23H,6,10,12-15,29H2,(H,33,37)(H4,30,31,32) |
| InChIKey | YIUUEKWYUCHZNU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 169.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|