C24H33N8O4S+ — CID 59961588
N-[(3S)-1-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-oxopyrrolidin-3-yl]-3-(1-methylpyridin-1-ium-4-yl)propanamide (PubChem CID 59961588) has the molecular formula C24H33N8O4S+ and a molecular weight of 529.65 g/mol. Its IUPAC name is N-[(3S)-1-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-oxopyrrolidin-3-yl]-3-(1-methylpyridin-1-ium-4-yl)propanamide.
| Compound Name | N-[(3S)-1-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-oxopyrrolidin-3-yl]-3-(1-methylpyridin-1-ium-4-yl)propanamide |
|---|---|
| PubChem CID | 59961588 |
| Molecular Formula | C24H33N8O4S+ |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | N-[(3S)-1-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-2-oxoethyl]-2-oxopyrrolidin-3-yl]-3-(1-methylpyridin-1-ium-4-yl)propanamide |
| SMILES | C[n+]1ccc(CCC(=O)N[C@H]2CCN(CC(=O)N[C@@H](CCCN=C(N)N)C(=O)c3nccs3)C2=O)cc1 |
| InChI | InChI=1S/C24H32N8O4S/c1-31-11-6-16(7-12-31)4-5-19(33)30-18-8-13-32(23(18)36)15-20(34)29-17(3-2-9-28-24(25)26)21(35)22-27-10-14-37-22/h6-7,10-12,14,17-18H,2-5,8-9,13,15H2,1H3,(H5-,25,26,28,29,30,33,34)/p+1/t17-,18-/m0/s1 |
| InChIKey | QSPQJYBKRGAQPA-ROUUACIJSA-O |
| XLogP | -0.96 |
| TPSA | 176.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|