C21H26ClN7O5S2 — CID 10099218
2-[4-(4-chlorophenyl)sulfonyl-2-oxopiperazin-1-yl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide (PubChem CID 10099218) has the molecular formula C21H26ClN7O5S2 and a molecular weight of 556.07 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonyl-2-oxopiperazin-1-yl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonyl-2-oxopiperazin-1-yl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 10099218 |
| Molecular Formula | C21H26ClN7O5S2 |
| Molecular Weight | 556.07 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonyl-2-oxopiperazin-1-yl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1=O)C(=O)c1nccs1 |
| InChI | InChI=1S/C21H26ClN7O5S2/c22-14-3-5-15(6-4-14)36(33,34)29-10-9-28(18(31)13-29)12-17(30)27-16(2-1-7-26-21(23)24)19(32)20-25-8-11-35-20/h3-6,8,11,16H,1-2,7,9-10,12-13H2,(H,27,30)(H4,23,24,26)/t16-/m0/s1 |
| InChIKey | RCRCIDZJGYMMJX-INIZCTEOSA-N |
| XLogP | 0.05 |
| TPSA | 181.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.07 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|