C22H29N7O3S — CID 18717732
2-(3-benzyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide (PubChem CID 18717732) has the molecular formula C22H29N7O3S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-(3-benzyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide.
| Compound Name | 2-(3-benzyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 18717732 |
| Molecular Formula | C22H29N7O3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-(3-benzyl-2-oxopiperazin-1-yl)-N-[5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
| SMILES | NC(N)=NCCCC(NC(=O)CN1CCNC(Cc2ccccc2)C1=O)C(=O)c1nccs1 |
| InChI | InChI=1S/C22H29N7O3S/c23-22(24)27-8-4-7-16(19(31)20-26-10-12-33-20)28-18(30)14-29-11-9-25-17(21(29)32)13-15-5-2-1-3-6-15/h1-3,5-6,10,12,16-17,25H,4,7-9,11,13-14H2,(H,28,30)(H4,23,24,27) |
| InChIKey | CVVJWXLMPOAYBP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|