C24H27N7O5S2 — CID 90837625
N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[2-oxo-3-(2-phenylethenylsulfonylamino)-1-pyridinyl]acetamide (PubChem CID 90837625) has the molecular formula C24H27N7O5S2 and a molecular weight of 557.66 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[2-oxo-3-(2-phenylethenylsulfonylamino)-1-pyridinyl]acetamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[2-oxo-3-(2-phenylethenylsulfonylamino)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 90837625 |
| Molecular Formula | C24H27N7O5S2 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[2-oxo-3-(2-phenylethenylsulfonylamino)-1-pyridinyl]acetamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)Cn1cccc(NS(=O)(=O)C=Cc2ccccc2)c1=O)C(=O)c1nccs1 |
| InChI | InChI=1S/C24H27N7O5S2/c25-24(26)28-11-4-8-18(21(33)22-27-12-14-37-22)29-20(32)16-31-13-5-9-19(23(31)34)30-38(35,36)15-10-17-6-2-1-3-7-17/h1-3,5-7,9-10,12-15,18,30H,4,8,11,16H2,(H,29,32)(H4,25,26,28)/t18-/m0/s1 |
| InChIKey | OCYHQLGIORSEDO-SFHVURJKSA-N |
| XLogP | 1.14 |
| TPSA | 191.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|