C21H28N6O7S — CID 22943369
N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide (PubChem CID 22943369) has the molecular formula C21H28N6O7S and a molecular weight of 508.56 g/mol. Its IUPAC name is N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 22943369 |
| Molecular Formula | C21H28N6O7S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccn(CC(=O)NC(C=O)CCCN=C(N)N)c2=O)cc1OC |
| InChI | InChI=1S/C21H28N6O7S/c1-33-17-8-7-15(11-18(17)34-2)35(31,32)26-16-6-4-10-27(20(16)30)12-19(29)25-14(13-28)5-3-9-24-21(22)23/h4,6-8,10-11,13-14,26H,3,5,9,12H2,1-2H3,(H,25,29)(H4,22,23,24) |
| InChIKey | HLYPOFXSVAITGN-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|