C21H27F3N6O9S — CID 87901645
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 87901645) has the molecular formula C21H27F3N6O9S and a molecular weight of 596.54 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87901645 |
| Molecular Formula | C21H27F3N6O9S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-dimethoxyphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C)n(CC(=O)NCCON=C(N)N)c2=O)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N6O7S.C2HF3O2/c1-12-4-6-14(18(27)25(12)11-17(26)22-8-9-32-23-19(20)21)24-33(28,29)13-5-7-15(30-2)16(10-13)31-3;3-2(4,5)1(6)7/h4-7,10,24H,8-9,11H2,1-3H3,(H,22,26)(H4,20,21,23);(H,6,7) |
| InChIKey | GLILMTXOLPNOGX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 226.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|