C19H28ClFN6O5S — CID 158639746
CID 158639746 (PubChem CID 158639746) has the molecular formula C19H28ClFN6O5S and a molecular weight of 509.00 g/mol.
| Compound Name | CID 158639746 |
|---|---|
| PubChem CID | 158639746 |
| Molecular Formula | C19H28ClFN6O5S |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | — |
| SMILES | C.Cc1c(Cl)cccc1S(=O)(=O)Nc1ccc(C)n(CC(=O)NCCON=C(N)N)c1=O.[3H]F |
| InChI | InChI=1S/C18H23ClN6O5S.CH4.FH/c1-11-6-7-14(24-31(28,29)15-5-3-4-13(19)12(15)2)17(27)25(11)10-16(26)22-8-9-30-23-18(20)21;;/h3-7,24H,8-10H2,1-2H3,(H,22,26)(H4,20,21,23);1H4;1H/i/hT |
| InChIKey | IAFPYAZDBBYFQI-MNYXATJNSA-N |
| XLogP | 1.03 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|