C18H21N7O5S — CID 22949230
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3-isocyanophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide (PubChem CID 22949230) has the molecular formula C18H21N7O5S and a molecular weight of 447.48 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3-isocyanophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3-isocyanophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 22949230 |
| Molecular Formula | C18H21N7O5S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3-isocyanophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide |
| SMILES | [C-]#[N+]c1cccc(S(=O)(=O)Nc2ccc(C)n(CC(=O)NCCON=C(N)N)c2=O)c1 |
| InChI | InChI=1S/C18H21N7O5S/c1-12-6-7-15(24-31(28,29)14-5-3-4-13(10-14)21-2)17(27)25(12)11-16(26)22-8-9-30-23-18(19)20/h3-7,10,24H,8-9,11H2,1H3,(H,22,26)(H4,19,20,23) |
| InChIKey | VHWGCOYCEAUYGF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 175.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|