C19H22F3IN6O7S — CID 87781778
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(4-iodophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 87781778) has the molecular formula C19H22F3IN6O7S and a molecular weight of 662.38 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(4-iodophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(4-iodophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87781778 |
| Molecular Formula | C19H22F3IN6O7S |
| Molecular Weight | 662.38 g/mol |
| Exact Mass | 662.03 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(4-iodophenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(I)cc2)c(=O)n1CC(=O)NCCON=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21IN6O5S.C2HF3O2/c1-11-2-7-14(23-30(27,28)13-5-3-12(18)4-6-13)16(26)24(11)10-15(25)21-8-9-29-22-17(19)20;3-2(4,5)1(6)7/h2-7,23H,8-10H2,1H3,(H,21,25)(H4,19,20,22);(H,6,7) |
| InChIKey | XRUFFGYZHVKQSK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 208.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|