C20H23Cl2F3N6O7S — CID 87782379
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(2,4-dichlorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 87782379) has the molecular formula C20H23Cl2F3N6O7S and a molecular weight of 619.41 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(2,4-dichlorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(2,4-dichlorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87782379 |
| Molecular Formula | C20H23Cl2F3N6O7S |
| Molecular Weight | 619.41 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(2,4-dichlorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)Cc2ccc(Cl)cc2Cl)c(=O)n1CC(=O)NCCON=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22Cl2N6O5S.C2HF3O2/c1-11-2-5-15(25-32(29,30)10-12-3-4-13(19)8-14(12)20)17(28)26(11)9-16(27)23-6-7-31-24-18(21)22;3-2(4,5)1(6)7/h2-5,8,25H,6-7,9-10H2,1H3,(H,23,27)(H4,21,22,24);(H,6,7) |
| InChIKey | COTRODALTJLEOY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 208.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|