C19H23F3N6O7S — CID 86760720
2-[3-(benzylsulfonylamino)-2-oxo-1-pyridinyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 86760720) has the molecular formula C19H23F3N6O7S and a molecular weight of 536.49 g/mol. Its IUPAC name is 2-[3-(benzylsulfonylamino)-2-oxo-1-pyridinyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-(benzylsulfonylamino)-2-oxo-1-pyridinyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86760720 |
| Molecular Formula | C19H23F3N6O7S |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-[3-(benzylsulfonylamino)-2-oxo-1-pyridinyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NOCCNC(=O)Cn1cccc(NS(=O)(=O)Cc2ccccc2)c1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N6O5S.C2HF3O2/c18-17(19)21-28-10-8-20-15(24)11-23-9-4-7-14(16(23)25)22-29(26,27)12-13-5-2-1-3-6-13;3-2(4,5)1(6)7/h1-7,9,22H,8,10-12H2,(H,20,24)(H4,18,19,21);(H,6,7) |
| InChIKey | OOGUDXVIZNMXRR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 208.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|